About N'-[(Z)-2-amino-1,2-dicyanoethenyl]-N-(4-aminophenyl)methanimidamide
N'-[(Z)-2-amino-1,2-dicyanoethenyl]-N-(4-aminophenyl)methanimidamide (PubChem CID 5468437) has the molecular formula C11H10N6
and a molecular weight of 226.24 g/mol. Its IUPAC name is N'-[(Z)-2-amino-1,2-dicyanoethenyl]-N-(4-aminophenyl)methanimidamide.
Molecular Properties
| Compound Name | N'-[(Z)-2-amino-1,2-dicyanoethenyl]-N-(4-aminophenyl)methanimidamide |
| PubChem CID | 5468437 |
| Molecular Formula | C11H10N6 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | N'-[(Z)-2-amino-1,2-dicyanoethenyl]-N-(4-aminophenyl)methanimidamide |
| SMILES | N#C/C(N)=C(C#N)/N=C/Nc1ccc(N)cc1 |
| InChI | InChI=1S/C11H10N6/c12-5-10(15)11(6-13)17-7-16-9-3-1-8(14)2-4-9/h1-4,7H,14-15H2,(H,16,17)/b11-10- |
| InChIKey | KPKLCXPLFDJFTK-KHPPLWFESA-N |
| XLogP | 0.93 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[(Z)-2-amino-1,2-dicyanoethenyl]-N-(4-aminophenyl)methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(Z)-2-amino-1,2-dicyanoethenyl]-N-(4-aminophenyl)methanimidamide?
The IUPAC name of N'-[(Z)-2-amino-1,2-dicyanoethenyl]-N-(4-aminophenyl)methanimidamide (CID 5468437) is N'-[(Z)-2-amino-1,2-dicyanoethenyl]-N-(4-aminophenyl)methanimidamide.
What is the SMILES notation for N'-[(Z)-2-amino-1,2-dicyanoethenyl]-N-(4-aminophenyl)methanimidamide?
The canonical SMILES for N'-[(Z)-2-amino-1,2-dicyanoethenyl]-N-(4-aminophenyl)methanimidamide is N#C/C(N)=C(C#N)/N=C/Nc1ccc(N)cc1.
What is the InChIKey of N'-[(Z)-2-amino-1,2-dicyanoethenyl]-N-(4-aminophenyl)methanimidamide?
The InChIKey is KPKLCXPLFDJFTK-KHPPLWFESA-N. The full InChI is InChI=1S/C11H10N6/c12-5-10(15)11(6-13)17-7-16-9-3-1-8(14)2-4-9/h1-4,7H,14-15H2,(H,16,17)/b11-10-.
What are the key properties of N'-[(Z)-2-amino-1,2-dicyanoethenyl]-N-(4-aminophenyl)methanimidamide?
N'-[(Z)-2-amino-1,2-dicyanoethenyl]-N-(4-aminophenyl)methanimidamide has a molecular weight of 226.24 g/mol, XLogP of 0.93, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(Z)-2-amino-1,2-dicyanoethenyl]-N-(4-aminophenyl)methanimidamide is sourced from PubChem (CID 5468437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).