C16H13F3N2O2S — CID 54684465
14-hydroxy-9-(trifluoromethyl)-12-thia-10,17-diazatetracyclo[9.7.0.02,8.013,18]octadeca-1(11),2(8),9,13(18),14-pentaen-16-one (PubChem CID 54684465) has the molecular formula C16H13F3N2O2S and a molecular weight of 354.35 g/mol. Its IUPAC name is 14-hydroxy-9-(trifluoromethyl)-12-thia-10,17-diazatetracyclo[9.7.0.02,8.013,18]octadeca-1(11),2(8),9,13(18),14-pentaen-16-one.
| Compound Name | 14-hydroxy-9-(trifluoromethyl)-12-thia-10,17-diazatetracyclo[9.7.0.02,8.013,18]octadeca-1(11),2(8),9,13(18),14-pentaen-16-one |
|---|---|
| PubChem CID | 54684465 |
| Molecular Formula | C16H13F3N2O2S |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 14-hydroxy-9-(trifluoromethyl)-12-thia-10,17-diazatetracyclo[9.7.0.02,8.013,18]octadeca-1(11),2(8),9,13(18),14-pentaen-16-one |
| SMILES | O=c1cc(O)c2sc3nc(C(F)(F)F)c4c(c3c2[nH]1)CCCCC4 |
| InChI | InChI=1S/C16H13F3N2O2S/c17-16(18,19)14-8-5-3-1-2-4-7(8)11-12-13(24-15(11)21-14)9(22)6-10(23)20-12/h6H,1-5H2,(H2,20,22,23) |
| InChIKey | BKSMOTMNWVIWPR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |