C17H24O5 — CID 54685134
(7R,8S)-4,8-dihydroxy-3,8-dimethyl-7-[(E,4S)-4-methylhex-2-en-2-yl]-5,7-dihydropyrano[4,3-b]pyran-2-one (PubChem CID 54685134) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is (7R,8S)-4,8-dihydroxy-3,8-dimethyl-7-[(E,4S)-4-methylhex-2-en-2-yl]-5,7-dihydropyrano[4,3-b]pyran-2-one.
| Compound Name | (7R,8S)-4,8-dihydroxy-3,8-dimethyl-7-[(E,4S)-4-methylhex-2-en-2-yl]-5,7-dihydropyrano[4,3-b]pyran-2-one |
|---|---|
| PubChem CID | 54685134 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (7R,8S)-4,8-dihydroxy-3,8-dimethyl-7-[(E,4S)-4-methylhex-2-en-2-yl]-5,7-dihydropyrano[4,3-b]pyran-2-one |
| SMILES | CC[C@H](C)/C=C(\C)[C@H]1OCc2c(oc(=O)c(C)c2O)[C@@]1(C)O |
| InChI | InChI=1S/C17H24O5/c1-6-9(2)7-10(3)14-17(5,20)15-12(8-21-14)13(18)11(4)16(19)22-15/h7,9,14,18,20H,6,8H2,1-5H3/b10-7+/t9-,14+,17-/m0/s1 |
| InChIKey | MBDAHWFPBNSYRC-WROLITJISA-N |
| XLogP | 2.75 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|