C18H24O — CID 5468522
4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenol (PubChem CID 5468522) has the molecular formula C18H24O and a molecular weight of 256.39 g/mol. Its IUPAC name is 4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenol.
| Compound Name | 4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenol |
|---|---|
| PubChem CID | 5468522 |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenol |
| SMILES | C=C[C@@](C)(/C=C/c1ccc(O)cc1)CCC=C(C)C |
| InChI | InChI=1S/C18H24O/c1-5-18(4,13-6-7-15(2)3)14-12-16-8-10-17(19)11-9-16/h5,7-12,14,19H,1,6,13H2,2-4H3/b14-12+/t18-/m1/s1 |
| InChIKey | LFYJSSARVMHQJB-QIXNEVBVSA-N |
| XLogP | 5.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|