C28H31N5O7 — CID 54685345
(4S,4aS,5aR,12aR)-9-(6-amino-3-pyridinyl)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54685345) has the molecular formula C28H31N5O7 and a molecular weight of 549.58 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-9-(6-amino-3-pyridinyl)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-9-(6-amino-3-pyridinyl)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54685345 |
| Molecular Formula | C28H31N5O7 |
| Molecular Weight | 549.58 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | (4S,4aS,5aR,12aR)-9-(6-amino-3-pyridinyl)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(-c2ccc(N)nc2)c(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C28H31N5O7/c1-32(2)16-9-13(11-5-6-17(29)31-10-11)22(34)19-14(16)7-12-8-15-21(33(3)4)24(36)20(27(30)39)26(38)28(15,40)25(37)18(12)23(19)35/h5-6,9-10,12,15,21,34-35,38,40H,7-8H2,1-4H3,(H2,29,31)(H2,30,39)/t12-,15-,21-,28-/m0/s1 |
| InChIKey | ICBODVKCUBUFLN-RBMSIWGPSA-N |
| XLogP | 0.67 |
| TPSA | 203.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.58 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|