C24H22O5S — CID 54685530
cyclopentyl 2-[(4-hydroxy-2-oxo-6-phenylpyran-3-yl)sulfanylmethyl]benzoate (PubChem CID 54685530) has the molecular formula C24H22O5S and a molecular weight of 422.50 g/mol. Its IUPAC name is cyclopentyl 2-[(4-hydroxy-2-oxo-6-phenylpyran-3-yl)sulfanylmethyl]benzoate.
| Compound Name | cyclopentyl 2-[(4-hydroxy-2-oxo-6-phenylpyran-3-yl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 54685530 |
| Molecular Formula | C24H22O5S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | cyclopentyl 2-[(4-hydroxy-2-oxo-6-phenylpyran-3-yl)sulfanylmethyl]benzoate |
| SMILES | O=C(OC1CCCC1)c1ccccc1CSc1c(O)cc(-c2ccccc2)oc1=O |
| InChI | InChI=1S/C24H22O5S/c25-20-14-21(16-8-2-1-3-9-16)29-24(27)22(20)30-15-17-10-4-7-13-19(17)23(26)28-18-11-5-6-12-18/h1-4,7-10,13-14,18,25H,5-6,11-12,15H2 |
| InChIKey | JBBSGFAPNHDPOI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |