C28H32FNO5S — CID 54685680
4-fluoro-N-[3-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)-3-methylbutyl]phenyl]benzenesulfonamide (PubChem CID 54685680) has the molecular formula C28H32FNO5S and a molecular weight of 513.63 g/mol. Its IUPAC name is 4-fluoro-N-[3-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)-3-methylbutyl]phenyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[3-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)-3-methylbutyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 54685680 |
| Molecular Formula | C28H32FNO5S |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | 4-fluoro-N-[3-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)-3-methylbutyl]phenyl]benzenesulfonamide |
| SMILES | CC(C)CC(c1cccc(NS(=O)(=O)c2ccc(F)cc2)c1)c1c(O)c2c(oc1=O)CCCCCC2 |
| InChI | InChI=1S/C28H32FNO5S/c1-18(2)16-24(26-27(31)23-10-5-3-4-6-11-25(23)35-28(26)32)19-8-7-9-21(17-19)30-36(33,34)22-14-12-20(29)13-15-22/h7-9,12-15,17-18,24,30-31H,3-6,10-11,16H2,1-2H3 |
| InChIKey | YQNOXGAZMZYQEE-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |