About methyl 2-hydroxy-6-(2-methoxycarbonyl-3-oxocycloheptyl)cyclohepta-1,6-diene-1-carboxylate
methyl 2-hydroxy-6-(2-methoxycarbonyl-3-oxocycloheptyl)cyclohepta-1,6-diene-1-carboxylate (PubChem CID 54685704) has the molecular formula C18H24O6
and a molecular weight of 336.38 g/mol. Its IUPAC name is methyl 2-hydroxy-6-(2-methoxycarbonyl-3-oxocycloheptyl)cyclohepta-1,6-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 2-hydroxy-6-(2-methoxycarbonyl-3-oxocycloheptyl)cyclohepta-1,6-diene-1-carboxylate |
| PubChem CID | 54685704 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | methyl 2-hydroxy-6-(2-methoxycarbonyl-3-oxocycloheptyl)cyclohepta-1,6-diene-1-carboxylate |
| SMILES | COC(=O)C1=C(O)CCCC(C2CCCCC(=O)C2C(=O)OC)=C1 |
| InChI | InChI=1S/C18H24O6/c1-23-17(21)13-10-11(6-5-9-14(13)19)12-7-3-4-8-15(20)16(12)18(22)24-2/h10,12,16,19H,3-9H2,1-2H3 |
| InChIKey | DNCPMBDRNMUOMB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-hydroxy-6-(2-methoxycarbonyl-3-oxocycloheptyl)cyclohepta-1,6-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-hydroxy-6-(2-methoxycarbonyl-3-oxocycloheptyl)cyclohepta-1,6-diene-1-carboxylate?
The IUPAC name of methyl 2-hydroxy-6-(2-methoxycarbonyl-3-oxocycloheptyl)cyclohepta-1,6-diene-1-carboxylate (CID 54685704) is methyl 2-hydroxy-6-(2-methoxycarbonyl-3-oxocycloheptyl)cyclohepta-1,6-diene-1-carboxylate.
What is the SMILES notation for methyl 2-hydroxy-6-(2-methoxycarbonyl-3-oxocycloheptyl)cyclohepta-1,6-diene-1-carboxylate?
The canonical SMILES for methyl 2-hydroxy-6-(2-methoxycarbonyl-3-oxocycloheptyl)cyclohepta-1,6-diene-1-carboxylate is COC(=O)C1=C(O)CCCC(C2CCCCC(=O)C2C(=O)OC)=C1.
What is the InChIKey of methyl 2-hydroxy-6-(2-methoxycarbonyl-3-oxocycloheptyl)cyclohepta-1,6-diene-1-carboxylate?
The InChIKey is DNCPMBDRNMUOMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24O6/c1-23-17(21)13-10-11(6-5-9-14(13)19)12-7-3-4-8-15(20)16(12)18(22)24-2/h10,12,16,19H,3-9H2,1-2H3.
What are the key properties of methyl 2-hydroxy-6-(2-methoxycarbonyl-3-oxocycloheptyl)cyclohepta-1,6-diene-1-carboxylate?
methyl 2-hydroxy-6-(2-methoxycarbonyl-3-oxocycloheptyl)cyclohepta-1,6-diene-1-carboxylate has a molecular weight of 336.38 g/mol, XLogP of 2.63, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-hydroxy-6-(2-methoxycarbonyl-3-oxocycloheptyl)cyclohepta-1,6-diene-1-carboxylate is sourced from PubChem (CID 54685704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).