C30H32N2O5S — CID 54685792
N-[3-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]phenyl]quinoline-8-sulfonamide (PubChem CID 54685792) has the molecular formula C30H32N2O5S and a molecular weight of 532.66 g/mol. Its IUPAC name is N-[3-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]phenyl]quinoline-8-sulfonamide.
| Compound Name | N-[3-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 54685792 |
| Molecular Formula | C30H32N2O5S |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | N-[3-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]phenyl]quinoline-8-sulfonamide |
| SMILES | CCCC(c1cccc(NS(=O)(=O)c2cccc3cccnc23)c1)c1c(O)c2c(oc1=O)CCCCCC2 |
| InChI | InChI=1S/C30H32N2O5S/c1-2-10-23(27-29(33)24-15-5-3-4-6-16-25(24)37-30(27)34)21-12-7-14-22(19-21)32-38(35,36)26-17-8-11-20-13-9-18-31-28(20)26/h7-9,11-14,17-19,23,32-33H,2-6,10,15-16H2,1H3 |
| InChIKey | UJHPSSIRIQYFHE-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |