C22H34O9 — CID 5468580
(1R,2R,3E,7S,11E,13S,15S)-2-hydroxy-7-methyl-15-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one (PubChem CID 5468580) has the molecular formula C22H34O9 and a molecular weight of 442.51 g/mol. Its IUPAC name is (1R,2R,3E,7S,11E,13S,15S)-2-hydroxy-7-methyl-15-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one.
| Compound Name | (1R,2R,3E,7S,11E,13S,15S)-2-hydroxy-7-methyl-15-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one |
|---|---|
| PubChem CID | 5468580 |
| Molecular Formula | C22H34O9 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | (1R,2R,3E,7S,11E,13S,15S)-2-hydroxy-7-methyl-15-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one |
| SMILES | C[C@H]1CCC/C=C/[C@@H]2C[C@H](OC3OC(CO)C(O)C(O)C3O)C[C@H]2[C@H](O)/C=C/C(=O)O1 |
| InChI | InChI=1S/C22H34O9/c1-12-5-3-2-4-6-13-9-14(10-15(13)16(24)7-8-18(25)29-12)30-22-21(28)20(27)19(26)17(11-23)31-22/h4,6-8,12-17,19-24,26-28H,2-3,5,9-11H2,1H3/b6-4+,8-7+/t12-,13+,14-,15+,16+,17?,19?,20?,21?,22?/m0/s1 |
| InChIKey | WMQPIXSJUDBUIO-BZTFNWKCSA-N |
| XLogP | -0.21 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|