C17H16F2NO4P — CID 5468612
(E)-2-diethoxyphosphoryl-3-[5-(2,4-difluorophenyl)furan-2-yl]prop-2-enenitrile (PubChem CID 5468612) has the molecular formula C17H16F2NO4P and a molecular weight of 367.29 g/mol. Its IUPAC name is (E)-2-diethoxyphosphoryl-3-[5-(2,4-difluorophenyl)furan-2-yl]prop-2-enenitrile.
| Compound Name | (E)-2-diethoxyphosphoryl-3-[5-(2,4-difluorophenyl)furan-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 5468612 |
| Molecular Formula | C17H16F2NO4P |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | (E)-2-diethoxyphosphoryl-3-[5-(2,4-difluorophenyl)furan-2-yl]prop-2-enenitrile |
| SMILES | CCOP(=O)(OCC)/C(C#N)=C/c1ccc(-c2ccc(F)cc2F)o1 |
| InChI | InChI=1S/C17H16F2NO4P/c1-3-22-25(21,23-4-2)14(11-20)10-13-6-8-17(24-13)15-7-5-12(18)9-16(15)19/h5-10H,3-4H2,1-2H3/b14-10+ |
| InChIKey | FYDLMUQEIBJKOB-GXDHUFHOSA-N |
| XLogP | 5.36 |
| TPSA | 72.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|