C18H9NO5 — CID 5468620
(10E)-10-[(4-nitrophenyl)methylidene]-2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraene-3,9-dione (PubChem CID 5468620) has the molecular formula C18H9NO5 and a molecular weight of 319.27 g/mol. Its IUPAC name is (10E)-10-[(4-nitrophenyl)methylidene]-2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraene-3,9-dione.
| Compound Name | (10E)-10-[(4-nitrophenyl)methylidene]-2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraene-3,9-dione |
|---|---|
| PubChem CID | 5468620 |
| Molecular Formula | C18H9NO5 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | (10E)-10-[(4-nitrophenyl)methylidene]-2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraene-3,9-dione |
| SMILES | O=c1oc2c/c(=C\c3ccc([N+](=O)[O-])cc3)c(=O)c3cccc1c3-2 |
| InChI | InChI=1S/C18H9NO5/c20-17-11(8-10-4-6-12(7-5-10)19(22)23)9-15-16-13(17)2-1-3-14(16)18(21)24-15/h1-9H/b11-8+ |
| InChIKey | KHKXRTOHHSKYNA-DHZHZOJOSA-N |
| XLogP | 2.15 |
| TPSA | 90.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|