About 2-carboxyphenolate;2-hydroxyethyl(trimethyl)azanium
2-carboxyphenolate;2-hydroxyethyl(trimethyl)azanium (PubChem CID 54686350) has the molecular formula C12H19NO4
and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-carboxyphenolate;2-hydroxyethyl(trimethyl)azanium.
Molecular Properties
| Compound Name | 2-carboxyphenolate;2-hydroxyethyl(trimethyl)azanium |
| PubChem CID | 54686350 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 2-carboxyphenolate;2-hydroxyethyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)CCO.O=C(O)c1ccccc1[O-] |
| InChI | InChI=1S/C7H6O3.C5H14NO/c8-6-4-2-1-3-5(6)7(9)10;1-6(2,3)4-5-7/h1-4,8H,(H,9,10);7H,4-5H2,1-3H3/q;+1/p-1 |
| InChIKey | UDKCHVLMFQVBAA-UHFFFAOYSA-M |
| XLogP | 0.14 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-carboxyphenolate;2-hydroxyethyl(trimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carboxyphenolate;2-hydroxyethyl(trimethyl)azanium?
The IUPAC name of 2-carboxyphenolate;2-hydroxyethyl(trimethyl)azanium (CID 54686350) is 2-carboxyphenolate;2-hydroxyethyl(trimethyl)azanium.
What is the SMILES notation for 2-carboxyphenolate;2-hydroxyethyl(trimethyl)azanium?
The canonical SMILES for 2-carboxyphenolate;2-hydroxyethyl(trimethyl)azanium is C[N+](C)(C)CCO.O=C(O)c1ccccc1[O-].
What is the InChIKey of 2-carboxyphenolate;2-hydroxyethyl(trimethyl)azanium?
The InChIKey is UDKCHVLMFQVBAA-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6O3.C5H14NO/c8-6-4-2-1-3-5(6)7(9)10;1-6(2,3)4-5-7/h1-4,8H,(H,9,10);7H,4-5H2,1-3H3/q;+1/p-1.
What are the key properties of 2-carboxyphenolate;2-hydroxyethyl(trimethyl)azanium?
2-carboxyphenolate;2-hydroxyethyl(trimethyl)azanium has a molecular weight of 241.29 g/mol, XLogP of 0.14, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carboxyphenolate;2-hydroxyethyl(trimethyl)azanium is sourced from PubChem (CID 54686350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).