About 1-butyl-N-(6-chloro-1,3-benzothiazol-2-yl)-4-hydroxy-2-oxoquinoline-3-carboxamide
1-butyl-N-(6-chloro-1,3-benzothiazol-2-yl)-4-hydroxy-2-oxoquinoline-3-carboxamide (PubChem CID 54686493) has the molecular formula C21H18ClN3O3S
and a molecular weight of 427.91 g/mol. Its IUPAC name is 1-butyl-N-(6-chloro-1,3-benzothiazol-2-yl)-4-hydroxy-2-oxoquinoline-3-carboxamide.
Molecular Properties
| Compound Name | 1-butyl-N-(6-chloro-1,3-benzothiazol-2-yl)-4-hydroxy-2-oxoquinoline-3-carboxamide |
| PubChem CID | 54686493 |
| Molecular Formula | C21H18ClN3O3S |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 1-butyl-N-(6-chloro-1,3-benzothiazol-2-yl)-4-hydroxy-2-oxoquinoline-3-carboxamide |
| SMILES | CCCCn1c(=O)c(C(=O)Nc2nc3ccc(Cl)cc3s2)c(O)c2ccccc21 |
| InChI | InChI=1S/C21H18ClN3O3S/c1-2-3-10-25-15-7-5-4-6-13(15)18(26)17(20(25)28)19(27)24-21-23-14-9-8-12(22)11-16(14)29-21/h4-9,11,26H,2-3,10H2,1H3,(H,23,24,27) |
| InChIKey | RAWZQAJAGNFDSN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-butyl-N-(6-chloro-1,3-benzothiazol-2-yl)-4-hydroxy-2-oxoquinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-N-(6-chloro-1,3-benzothiazol-2-yl)-4-hydroxy-2-oxoquinoline-3-carboxamide?
The IUPAC name of 1-butyl-N-(6-chloro-1,3-benzothiazol-2-yl)-4-hydroxy-2-oxoquinoline-3-carboxamide (CID 54686493) is 1-butyl-N-(6-chloro-1,3-benzothiazol-2-yl)-4-hydroxy-2-oxoquinoline-3-carboxamide.
What is the SMILES notation for 1-butyl-N-(6-chloro-1,3-benzothiazol-2-yl)-4-hydroxy-2-oxoquinoline-3-carboxamide?
The canonical SMILES for 1-butyl-N-(6-chloro-1,3-benzothiazol-2-yl)-4-hydroxy-2-oxoquinoline-3-carboxamide is CCCCn1c(=O)c(C(=O)Nc2nc3ccc(Cl)cc3s2)c(O)c2ccccc21.
What is the InChIKey of 1-butyl-N-(6-chloro-1,3-benzothiazol-2-yl)-4-hydroxy-2-oxoquinoline-3-carboxamide?
The InChIKey is RAWZQAJAGNFDSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18ClN3O3S/c1-2-3-10-25-15-7-5-4-6-13(15)18(26)17(20(25)28)19(27)24-21-23-14-9-8-12(22)11-16(14)29-21/h4-9,11,26H,2-3,10H2,1H3,(H,23,24,27).
What are the key properties of 1-butyl-N-(6-chloro-1,3-benzothiazol-2-yl)-4-hydroxy-2-oxoquinoline-3-carboxamide?
1-butyl-N-(6-chloro-1,3-benzothiazol-2-yl)-4-hydroxy-2-oxoquinoline-3-carboxamide has a molecular weight of 427.91 g/mol, XLogP of 5.02, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-N-(6-chloro-1,3-benzothiazol-2-yl)-4-hydroxy-2-oxoquinoline-3-carboxamide is sourced from PubChem (CID 54686493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).