C24H23F2N5O5 — CID 54686525
N-[(2,4-difluorophenyl)methyl]-5-hydroxy-3-(2-methoxyethyl)-4,6-dioxo-1-(pyridin-2-ylmethyl)-2H-pyrido[2,1-f][1,2,4]triazine-7-carboxamide (PubChem CID 54686525) has the molecular formula C24H23F2N5O5 and a molecular weight of 499.47 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-5-hydroxy-3-(2-methoxyethyl)-4,6-dioxo-1-(pyridin-2-ylmethyl)-2H-pyrido[2,1-f][1,2,4]triazine-7-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-5-hydroxy-3-(2-methoxyethyl)-4,6-dioxo-1-(pyridin-2-ylmethyl)-2H-pyrido[2,1-f][1,2,4]triazine-7-carboxamide |
|---|---|
| PubChem CID | 54686525 |
| Molecular Formula | C24H23F2N5O5 |
| Molecular Weight | 499.47 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-5-hydroxy-3-(2-methoxyethyl)-4,6-dioxo-1-(pyridin-2-ylmethyl)-2H-pyrido[2,1-f][1,2,4]triazine-7-carboxamide |
| SMILES | COCCN1CN(Cc2ccccn2)n2cc(C(=O)NCc3ccc(F)cc3F)c(=O)c(O)c2C1=O |
| InChI | InChI=1S/C24H23F2N5O5/c1-36-9-8-29-14-30(12-17-4-2-3-7-27-17)31-13-18(21(32)22(33)20(31)24(29)35)23(34)28-11-15-5-6-16(25)10-19(15)26/h2-7,10,13,33H,8-9,11-12,14H2,1H3,(H,28,34) |
| InChIKey | LJWLTXAXGYAGQK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.47 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |