About 5-ethyl-4-hydroxy-1,3,6-triphenylpyridin-2-one
5-ethyl-4-hydroxy-1,3,6-triphenylpyridin-2-one (PubChem CID 54686582) has the molecular formula C25H21NO2
and a molecular weight of 367.45 g/mol. Its IUPAC name is 5-ethyl-4-hydroxy-1,3,6-triphenylpyridin-2-one.
Molecular Properties
| Compound Name | 5-ethyl-4-hydroxy-1,3,6-triphenylpyridin-2-one |
| PubChem CID | 54686582 |
| Molecular Formula | C25H21NO2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 5-ethyl-4-hydroxy-1,3,6-triphenylpyridin-2-one |
| SMILES | CCc1c(O)c(-c2ccccc2)c(=O)n(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C25H21NO2/c1-2-21-23(19-14-8-4-9-15-19)26(20-16-10-5-11-17-20)25(28)22(24(21)27)18-12-6-3-7-13-18/h3-17,27H,2H2,1H3 |
| InChIKey | JHUWHRCMCKFQPV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethyl-4-hydroxy-1,3,6-triphenylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-4-hydroxy-1,3,6-triphenylpyridin-2-one?
The IUPAC name of 5-ethyl-4-hydroxy-1,3,6-triphenylpyridin-2-one (CID 54686582) is 5-ethyl-4-hydroxy-1,3,6-triphenylpyridin-2-one.
What is the SMILES notation for 5-ethyl-4-hydroxy-1,3,6-triphenylpyridin-2-one?
The canonical SMILES for 5-ethyl-4-hydroxy-1,3,6-triphenylpyridin-2-one is CCc1c(O)c(-c2ccccc2)c(=O)n(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 5-ethyl-4-hydroxy-1,3,6-triphenylpyridin-2-one?
The InChIKey is JHUWHRCMCKFQPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21NO2/c1-2-21-23(19-14-8-4-9-15-19)26(20-16-10-5-11-17-20)25(28)22(24(21)27)18-12-6-3-7-13-18/h3-17,27H,2H2,1H3.
What are the key properties of 5-ethyl-4-hydroxy-1,3,6-triphenylpyridin-2-one?
5-ethyl-4-hydroxy-1,3,6-triphenylpyridin-2-one has a molecular weight of 367.45 g/mol, XLogP of 5.44, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-4-hydroxy-1,3,6-triphenylpyridin-2-one is sourced from PubChem (CID 54686582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).