About 3-benzyl-4,5-dihydroxychromen-2-one
3-benzyl-4,5-dihydroxychromen-2-one (PubChem CID 54686605) has the molecular formula C16H12O4
and a molecular weight of 268.27 g/mol. Its IUPAC name is 3-benzyl-4,5-dihydroxychromen-2-one.
Molecular Properties
| Compound Name | 3-benzyl-4,5-dihydroxychromen-2-one |
| PubChem CID | 54686605 |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 3-benzyl-4,5-dihydroxychromen-2-one |
| SMILES | O=c1oc2cccc(O)c2c(O)c1Cc1ccccc1 |
| InChI | InChI=1S/C16H12O4/c17-12-7-4-8-13-14(12)15(18)11(16(19)20-13)9-10-5-2-1-3-6-10/h1-8,17-18H,9H2 |
| InChIKey | SLSNVVVTKCREAW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-4,5-dihydroxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-4,5-dihydroxychromen-2-one?
The IUPAC name of 3-benzyl-4,5-dihydroxychromen-2-one (CID 54686605) is 3-benzyl-4,5-dihydroxychromen-2-one.
What is the SMILES notation for 3-benzyl-4,5-dihydroxychromen-2-one?
The canonical SMILES for 3-benzyl-4,5-dihydroxychromen-2-one is O=c1oc2cccc(O)c2c(O)c1Cc1ccccc1.
What is the InChIKey of 3-benzyl-4,5-dihydroxychromen-2-one?
The InChIKey is SLSNVVVTKCREAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O4/c17-12-7-4-8-13-14(12)15(18)11(16(19)20-13)9-10-5-2-1-3-6-10/h1-8,17-18H,9H2.
What are the key properties of 3-benzyl-4,5-dihydroxychromen-2-one?
3-benzyl-4,5-dihydroxychromen-2-one has a molecular weight of 268.27 g/mol, XLogP of 2.80, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-4,5-dihydroxychromen-2-one is sourced from PubChem (CID 54686605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).