C21H34O6 — CID 54686717
(3Z,6R)-3-[(E,4R,8S,9R,10S)-1,9-dihydroxy-8-(hydroxymethyl)-4,10-dimethyldodec-6-enylidene]-6-methyloxane-2,4-dione (PubChem CID 54686717) has the molecular formula C21H34O6 and a molecular weight of 382.50 g/mol. Its IUPAC name is (3Z,6R)-3-[(E,4R,8S,9R,10S)-1,9-dihydroxy-8-(hydroxymethyl)-4,10-dimethyldodec-6-enylidene]-6-methyloxane-2,4-dione.
| Compound Name | (3Z,6R)-3-[(E,4R,8S,9R,10S)-1,9-dihydroxy-8-(hydroxymethyl)-4,10-dimethyldodec-6-enylidene]-6-methyloxane-2,4-dione |
|---|---|
| PubChem CID | 54686717 |
| Molecular Formula | C21H34O6 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | (3Z,6R)-3-[(E,4R,8S,9R,10S)-1,9-dihydroxy-8-(hydroxymethyl)-4,10-dimethyldodec-6-enylidene]-6-methyloxane-2,4-dione |
| SMILES | CC[C@H](C)[C@@H](O)[C@@H](/C=C/C[C@H](C)CC/C(O)=C1\C(=O)C[C@@H](C)OC1=O)CO |
| InChI | InChI=1S/C21H34O6/c1-5-14(3)20(25)16(12-22)8-6-7-13(2)9-10-17(23)19-18(24)11-15(4)27-21(19)26/h6,8,13-16,20,22-23,25H,5,7,9-12H2,1-4H3/b8-6+,19-17-/t13-,14-,15+,16-,20+/m0/s1 |
| InChIKey | XXENLLVGEXIITF-LAIQGSQRSA-N |
| XLogP | 3.08 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|