C17H16F9NO4S — CID 5468675
ethyl (E)-3-[4-(dimethylamino)phenyl]-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)prop-2-enoate (PubChem CID 5468675) has the molecular formula C17H16F9NO4S and a molecular weight of 501.37 g/mol. Its IUPAC name is ethyl (E)-3-[4-(dimethylamino)phenyl]-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-(dimethylamino)phenyl]-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)prop-2-enoate |
|---|---|
| PubChem CID | 5468675 |
| Molecular Formula | C17H16F9NO4S |
| Molecular Weight | 501.37 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | ethyl (E)-3-[4-(dimethylamino)phenyl]-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C\c1ccc(N(C)C)cc1)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H16F9NO4S/c1-4-31-13(28)12(9-10-5-7-11(8-6-10)27(2)3)32(29,30)17(25,26)15(20,21)14(18,19)16(22,23)24/h5-9H,4H2,1-3H3/b12-9+ |
| InChIKey | YJYBQFZUOVGCIU-FMIVXFBMSA-N |
| XLogP | 4.50 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|