C14H13NO4 — CID 54686852
ethyl (5Z)-5-benzylidene-4-hydroxy-2-oxopyrrole-3-carboxylate (PubChem CID 54686852) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is ethyl (5Z)-5-benzylidene-4-hydroxy-2-oxopyrrole-3-carboxylate.
| Compound Name | ethyl (5Z)-5-benzylidene-4-hydroxy-2-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 54686852 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | ethyl (5Z)-5-benzylidene-4-hydroxy-2-oxopyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2ccccc2)NC1=O |
| InChI | InChI=1S/C14H13NO4/c1-2-19-14(18)11-12(16)10(15-13(11)17)8-9-6-4-3-5-7-9/h3-8,16H,2H2,1H3,(H,15,17)/b10-8- |
| InChIKey | BPPWOMMMGZECNL-NTMALXAHSA-N |
| XLogP | 1.53 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|