About 6-benzyl-7-hydroxy-2,3-dihydro-1H-indolizin-5-one
6-benzyl-7-hydroxy-2,3-dihydro-1H-indolizin-5-one (PubChem CID 54687028) has the molecular formula C15H15NO2
and a molecular weight of 241.29 g/mol. Its IUPAC name is 6-benzyl-7-hydroxy-2,3-dihydro-1H-indolizin-5-one.
Molecular Properties
| Compound Name | 6-benzyl-7-hydroxy-2,3-dihydro-1H-indolizin-5-one |
| PubChem CID | 54687028 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 6-benzyl-7-hydroxy-2,3-dihydro-1H-indolizin-5-one |
| SMILES | O=c1c(Cc2ccccc2)c(O)cc2n1CCC2 |
| InChI | InChI=1S/C15H15NO2/c17-14-10-12-7-4-8-16(12)15(18)13(14)9-11-5-2-1-3-6-11/h1-3,5-6,10,17H,4,7-9H2 |
| InChIKey | ORZIYCYODHTTOR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-benzyl-7-hydroxy-2,3-dihydro-1H-indolizin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzyl-7-hydroxy-2,3-dihydro-1H-indolizin-5-one?
The IUPAC name of 6-benzyl-7-hydroxy-2,3-dihydro-1H-indolizin-5-one (CID 54687028) is 6-benzyl-7-hydroxy-2,3-dihydro-1H-indolizin-5-one.
What is the SMILES notation for 6-benzyl-7-hydroxy-2,3-dihydro-1H-indolizin-5-one?
The canonical SMILES for 6-benzyl-7-hydroxy-2,3-dihydro-1H-indolizin-5-one is O=c1c(Cc2ccccc2)c(O)cc2n1CCC2.
What is the InChIKey of 6-benzyl-7-hydroxy-2,3-dihydro-1H-indolizin-5-one?
The InChIKey is ORZIYCYODHTTOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2/c17-14-10-12-7-4-8-16(12)15(18)13(14)9-11-5-2-1-3-6-11/h1-3,5-6,10,17H,4,7-9H2.
What are the key properties of 6-benzyl-7-hydroxy-2,3-dihydro-1H-indolizin-5-one?
6-benzyl-7-hydroxy-2,3-dihydro-1H-indolizin-5-one has a molecular weight of 241.29 g/mol, XLogP of 2.09, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzyl-7-hydroxy-2,3-dihydro-1H-indolizin-5-one is sourced from PubChem (CID 54687028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).