C28H40O5Si — CID 5468734
6-[(1R,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylbut-3-enyl]-5-hydroxy-2,2-dimethyl-10-propylpyrano[2,3-f]chromen-8-one (PubChem CID 5468734) has the molecular formula C28H40O5Si and a molecular weight of 484.71 g/mol. Its IUPAC name is 6-[(1R,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylbut-3-enyl]-5-hydroxy-2,2-dimethyl-10-propylpyrano[2,3-f]chromen-8-one.
| Compound Name | 6-[(1R,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylbut-3-enyl]-5-hydroxy-2,2-dimethyl-10-propylpyrano[2,3-f]chromen-8-one |
|---|---|
| PubChem CID | 5468734 |
| Molecular Formula | C28H40O5Si |
| Molecular Weight | 484.71 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 6-[(1R,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylbut-3-enyl]-5-hydroxy-2,2-dimethyl-10-propylpyrano[2,3-f]chromen-8-one |
| SMILES | C=C[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)c1c(O)c2c(c3c(CCC)cc(=O)oc13)OC(C)(C)C=C2 |
| InChI | InChI=1S/C28H40O5Si/c1-11-13-18-16-20(29)31-26-21(18)25-19(14-15-28(7,8)32-25)23(30)22(26)24(17(3)12-2)33-34(9,10)27(4,5)6/h12,14-17,24,30H,2,11,13H2,1,3-10H3/t17-,24-/m1/s1 |
| InChIKey | SMAZCFGMKKDCDS-MZNJEOGPSA-N |
| XLogP | 7.52 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.71 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|