C18H22NO4- — CID 54687383
6-butoxy-1-butyl-3-carboxyisoquinolin-4-olate (PubChem CID 54687383) has the molecular formula C18H22NO4- and a molecular weight of 316.38 g/mol. Its IUPAC name is 6-butoxy-1-butyl-3-carboxyisoquinolin-4-olate.
| Compound Name | 6-butoxy-1-butyl-3-carboxyisoquinolin-4-olate |
|---|---|
| PubChem CID | 54687383 |
| Molecular Formula | C18H22NO4- |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 6-butoxy-1-butyl-3-carboxyisoquinolin-4-olate |
| SMILES | CCCCOc1ccc2c(CCCC)nc(C(=O)O)c([O-])c2c1 |
| InChI | InChI=1S/C18H23NO4/c1-3-5-7-15-13-9-8-12(23-10-6-4-2)11-14(13)17(20)16(19-15)18(21)22/h8-9,11,20H,3-7,10H2,1-2H3,(H,21,22)/p-1 |
| InChIKey | HWJDYTBNUPDKDE-UHFFFAOYSA-M |
| XLogP | 3.53 |
| TPSA | 82.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|