C22H19NO7 — CID 54687683
6-hydroxy-8-methoxy-5-[(4-methylanilino)methyl]-3,11,13-trioxatetracyclo[8.6.0.02,7.012,16]hexadeca-1,5,7,9-tetraene-4,14-dione (PubChem CID 54687683) has the molecular formula C22H19NO7 and a molecular weight of 409.39 g/mol. Its IUPAC name is 6-hydroxy-8-methoxy-5-[(4-methylanilino)methyl]-3,11,13-trioxatetracyclo[8.6.0.02,7.012,16]hexadeca-1,5,7,9-tetraene-4,14-dione.
| Compound Name | 6-hydroxy-8-methoxy-5-[(4-methylanilino)methyl]-3,11,13-trioxatetracyclo[8.6.0.02,7.012,16]hexadeca-1,5,7,9-tetraene-4,14-dione |
|---|---|
| PubChem CID | 54687683 |
| Molecular Formula | C22H19NO7 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 6-hydroxy-8-methoxy-5-[(4-methylanilino)methyl]-3,11,13-trioxatetracyclo[8.6.0.02,7.012,16]hexadeca-1,5,7,9-tetraene-4,14-dione |
| SMILES | COc1cc2c(c3oc(=O)c(CNc4ccc(C)cc4)c(O)c13)C1CC(=O)OC1O2 |
| InChI | InChI=1S/C22H19NO7/c1-10-3-5-11(6-4-10)23-9-13-19(25)18-14(27-2)8-15-17(20(18)30-21(13)26)12-7-16(24)29-22(12)28-15/h3-6,8,12,22-23,25H,7,9H2,1-2H3 |
| InChIKey | BHQTZCMYVFHBHB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|