About 5,7-dimethyl-2-naphthalen-1-yl-1H-1,8-naphthyridin-4-one
5,7-dimethyl-2-naphthalen-1-yl-1H-1,8-naphthyridin-4-one (PubChem CID 5468781) has the molecular formula C20H16N2O
and a molecular weight of 300.36 g/mol. Its IUPAC name is 5,7-dimethyl-2-naphthalen-1-yl-1H-1,8-naphthyridin-4-one.
Molecular Properties
| Compound Name | 5,7-dimethyl-2-naphthalen-1-yl-1H-1,8-naphthyridin-4-one |
| PubChem CID | 5468781 |
| Molecular Formula | C20H16N2O |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 5,7-dimethyl-2-naphthalen-1-yl-1H-1,8-naphthyridin-4-one |
| SMILES | Cc1cc(C)c2c(=O)cc(-c3cccc4ccccc34)[nH]c2n1 |
| InChI | InChI=1S/C20H16N2O/c1-12-10-13(2)21-20-19(12)18(23)11-17(22-20)16-9-5-7-14-6-3-4-8-15(14)16/h3-11H,1-2H3,(H,21,22,23) |
| InChIKey | OKROBUVTAGQCKV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,7-dimethyl-2-naphthalen-1-yl-1H-1,8-naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethyl-2-naphthalen-1-yl-1H-1,8-naphthyridin-4-one?
The IUPAC name of 5,7-dimethyl-2-naphthalen-1-yl-1H-1,8-naphthyridin-4-one (CID 5468781) is 5,7-dimethyl-2-naphthalen-1-yl-1H-1,8-naphthyridin-4-one.
What is the SMILES notation for 5,7-dimethyl-2-naphthalen-1-yl-1H-1,8-naphthyridin-4-one?
The canonical SMILES for 5,7-dimethyl-2-naphthalen-1-yl-1H-1,8-naphthyridin-4-one is Cc1cc(C)c2c(=O)cc(-c3cccc4ccccc34)[nH]c2n1.
What is the InChIKey of 5,7-dimethyl-2-naphthalen-1-yl-1H-1,8-naphthyridin-4-one?
The InChIKey is OKROBUVTAGQCKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2O/c1-12-10-13(2)21-20-19(12)18(23)11-17(22-20)16-9-5-7-14-6-3-4-8-15(14)16/h3-11H,1-2H3,(H,21,22,23).
What are the key properties of 5,7-dimethyl-2-naphthalen-1-yl-1H-1,8-naphthyridin-4-one?
5,7-dimethyl-2-naphthalen-1-yl-1H-1,8-naphthyridin-4-one has a molecular weight of 300.36 g/mol, XLogP of 4.36, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethyl-2-naphthalen-1-yl-1H-1,8-naphthyridin-4-one is sourced from PubChem (CID 5468781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).