C23H24O4 — CID 54687909
4-[cyclopropyl(phenyl)methyl]-3-hydroxy-2-(1-hydroxy-3-phenylpropyl)-2H-furan-5-one (PubChem CID 54687909) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is 4-[cyclopropyl(phenyl)methyl]-3-hydroxy-2-(1-hydroxy-3-phenylpropyl)-2H-furan-5-one.
| Compound Name | 4-[cyclopropyl(phenyl)methyl]-3-hydroxy-2-(1-hydroxy-3-phenylpropyl)-2H-furan-5-one |
|---|---|
| PubChem CID | 54687909 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 4-[cyclopropyl(phenyl)methyl]-3-hydroxy-2-(1-hydroxy-3-phenylpropyl)-2H-furan-5-one |
| SMILES | O=C1OC(C(O)CCc2ccccc2)C(O)=C1C(c1ccccc1)C1CC1 |
| InChI | InChI=1S/C23H24O4/c24-18(14-11-15-7-3-1-4-8-15)22-21(25)20(23(26)27-22)19(17-12-13-17)16-9-5-2-6-10-16/h1-10,17-19,22,24-25H,11-14H2 |
| InChIKey | JHIFIUXVEYPGAE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |