C16H16ClNS3 — CID 5468799
N-[3-[(E)-but-2-enyl]sulfanyl-4-chlorophenyl]-2-methylthiophene-3-carbothioamide (PubChem CID 5468799) has the molecular formula C16H16ClNS3 and a molecular weight of 353.97 g/mol. Its IUPAC name is N-[3-[(E)-but-2-enyl]sulfanyl-4-chlorophenyl]-2-methylthiophene-3-carbothioamide.
| Compound Name | N-[3-[(E)-but-2-enyl]sulfanyl-4-chlorophenyl]-2-methylthiophene-3-carbothioamide |
|---|---|
| PubChem CID | 5468799 |
| Molecular Formula | C16H16ClNS3 |
| Molecular Weight | 353.97 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | N-[3-[(E)-but-2-enyl]sulfanyl-4-chlorophenyl]-2-methylthiophene-3-carbothioamide |
| SMILES | C/C=C/CSc1cc(NC(=S)c2ccsc2C)ccc1Cl |
| InChI | InChI=1S/C16H16ClNS3/c1-3-4-8-21-15-10-12(5-6-14(15)17)18-16(19)13-7-9-20-11(13)2/h3-7,9-10H,8H2,1-2H3,(H,18,19)/b4-3+ |
| InChIKey | NLFLVHAFOCGXJG-ONEGZZNKSA-N |
| XLogP | 6.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.97 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|