C27H30FNO5S — CID 54688013
4-fluoro-N-[3-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]phenyl]benzenesulfonamide (PubChem CID 54688013) has the molecular formula C27H30FNO5S and a molecular weight of 499.60 g/mol. Its IUPAC name is 4-fluoro-N-[3-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]phenyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[3-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 54688013 |
| Molecular Formula | C27H30FNO5S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 4-fluoro-N-[3-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]phenyl]benzenesulfonamide |
| SMILES | CCCC(c1cccc(NS(=O)(=O)c2ccc(F)cc2)c1)c1c(O)c2c(oc1=O)CCCCCC2 |
| InChI | InChI=1S/C27H30FNO5S/c1-2-8-22(25-26(30)23-11-5-3-4-6-12-24(23)34-27(25)31)18-9-7-10-20(17-18)29-35(32,33)21-15-13-19(28)14-16-21/h7,9-10,13-17,22,29-30H,2-6,8,11-12H2,1H3 |
| InChIKey | LLMTYJLMNZMATO-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |