C12H18O3 — CID 54688198
(3R,4aR)-8-hydroxy-3-propan-2-yl-3,4,4a,5,6,7-hexahydroisochromen-1-one (PubChem CID 54688198) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (3R,4aR)-8-hydroxy-3-propan-2-yl-3,4,4a,5,6,7-hexahydroisochromen-1-one.
| Compound Name | (3R,4aR)-8-hydroxy-3-propan-2-yl-3,4,4a,5,6,7-hexahydroisochromen-1-one |
|---|---|
| PubChem CID | 54688198 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (3R,4aR)-8-hydroxy-3-propan-2-yl-3,4,4a,5,6,7-hexahydroisochromen-1-one |
| SMILES | CC(C)[C@H]1C[C@H]2CCCC(O)=C2C(=O)O1 |
| InChI | InChI=1S/C12H18O3/c1-7(2)10-6-8-4-3-5-9(13)11(8)12(14)15-10/h7-8,10,13H,3-6H2,1-2H3/t8-,10-/m1/s1 |
| InChIKey | UMPSQDALZZISTC-PSASIEDQSA-N |
| XLogP | 2.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |