C13H20O3 — CID 54688199
(3S,4aR)-3-butyl-8-hydroxy-3,4,4a,5,6,7-hexahydroisochromen-1-one (PubChem CID 54688199) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (3S,4aR)-3-butyl-8-hydroxy-3,4,4a,5,6,7-hexahydroisochromen-1-one.
| Compound Name | (3S,4aR)-3-butyl-8-hydroxy-3,4,4a,5,6,7-hexahydroisochromen-1-one |
|---|---|
| PubChem CID | 54688199 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (3S,4aR)-3-butyl-8-hydroxy-3,4,4a,5,6,7-hexahydroisochromen-1-one |
| SMILES | CCCC[C@H]1C[C@H]2CCCC(O)=C2C(=O)O1 |
| InChI | InChI=1S/C13H20O3/c1-2-3-6-10-8-9-5-4-7-11(14)12(9)13(15)16-10/h9-10,14H,2-8H2,1H3/t9-,10+/m1/s1 |
| InChIKey | NHJHIAVQRXJFHP-ZJUUUORDSA-N |
| XLogP | 3.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |