C12H13NO — CID 5468825
(NZ)-N-(3,5,6,7-tetrahydro-2H-s-indacen-1-ylidene)hydroxylamine (PubChem CID 5468825) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is (NZ)-N-(3,5,6,7-tetrahydro-2H-s-indacen-1-ylidene)hydroxylamine.
| Compound Name | (NZ)-N-(3,5,6,7-tetrahydro-2H-s-indacen-1-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 5468825 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | (NZ)-N-(3,5,6,7-tetrahydro-2H-s-indacen-1-ylidene)hydroxylamine |
| SMILES | O/N=C1/CCc2cc3c(cc21)CCC3 |
| InChI | InChI=1S/C12H13NO/c14-13-12-5-4-10-6-8-2-1-3-9(8)7-11(10)12/h6-7,14H,1-5H2/b13-12- |
| InChIKey | WWSUHMFQLNZTPL-SEYXRHQNSA-N |
| XLogP | 2.30 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|