About (3Z)-3-[(2,4-dimethoxypyrimidin-5-yl)methylidene]-2-benzofuran-1-one
(3Z)-3-[(2,4-dimethoxypyrimidin-5-yl)methylidene]-2-benzofuran-1-one (PubChem CID 5468846) has the molecular formula C15H12N2O4
and a molecular weight of 284.27 g/mol. Its IUPAC name is (3Z)-3-[(2,4-dimethoxypyrimidin-5-yl)methylidene]-2-benzofuran-1-one.
Molecular Properties
| Compound Name | (3Z)-3-[(2,4-dimethoxypyrimidin-5-yl)methylidene]-2-benzofuran-1-one |
| PubChem CID | 5468846 |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | (3Z)-3-[(2,4-dimethoxypyrimidin-5-yl)methylidene]-2-benzofuran-1-one |
| SMILES | COc1ncc(/C=C2\OC(=O)c3ccccc32)c(OC)n1 |
| InChI | InChI=1S/C15H12N2O4/c1-19-13-9(8-16-15(17-13)20-2)7-12-10-5-3-4-6-11(10)14(18)21-12/h3-8H,1-2H3/b12-7- |
| InChIKey | CMNMPKRDOUHXQU-GHXNOFRVSA-N |
| XLogP | 2.16 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3Z)-3-[(2,4-dimethoxypyrimidin-5-yl)methylidene]-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-[(2,4-dimethoxypyrimidin-5-yl)methylidene]-2-benzofuran-1-one?
The IUPAC name of (3Z)-3-[(2,4-dimethoxypyrimidin-5-yl)methylidene]-2-benzofuran-1-one (CID 5468846) is (3Z)-3-[(2,4-dimethoxypyrimidin-5-yl)methylidene]-2-benzofuran-1-one.
What is the SMILES notation for (3Z)-3-[(2,4-dimethoxypyrimidin-5-yl)methylidene]-2-benzofuran-1-one?
The canonical SMILES for (3Z)-3-[(2,4-dimethoxypyrimidin-5-yl)methylidene]-2-benzofuran-1-one is COc1ncc(/C=C2\OC(=O)c3ccccc32)c(OC)n1.
What is the InChIKey of (3Z)-3-[(2,4-dimethoxypyrimidin-5-yl)methylidene]-2-benzofuran-1-one?
The InChIKey is CMNMPKRDOUHXQU-GHXNOFRVSA-N. The full InChI is InChI=1S/C15H12N2O4/c1-19-13-9(8-16-15(17-13)20-2)7-12-10-5-3-4-6-11(10)14(18)21-12/h3-8H,1-2H3/b12-7-.
What are the key properties of (3Z)-3-[(2,4-dimethoxypyrimidin-5-yl)methylidene]-2-benzofuran-1-one?
(3Z)-3-[(2,4-dimethoxypyrimidin-5-yl)methylidene]-2-benzofuran-1-one has a molecular weight of 284.27 g/mol, XLogP of 2.16, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-[(2,4-dimethoxypyrimidin-5-yl)methylidene]-2-benzofuran-1-one is sourced from PubChem (CID 5468846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).