C20H28O4 — CID 5468862
(1S,2R,5S,6E,10R,11S,12R,16S)-2,6,10-trimethyl-15-methylidene-13,18,19-trioxatetracyclo[9.6.1.12,5.012,16]nonadec-6-en-14-one (PubChem CID 5468862) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (1S,2R,5S,6E,10R,11S,12R,16S)-2,6,10-trimethyl-15-methylidene-13,18,19-trioxatetracyclo[9.6.1.12,5.012,16]nonadec-6-en-14-one.
| Compound Name | (1S,2R,5S,6E,10R,11S,12R,16S)-2,6,10-trimethyl-15-methylidene-13,18,19-trioxatetracyclo[9.6.1.12,5.012,16]nonadec-6-en-14-one |
|---|---|
| PubChem CID | 5468862 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (1S,2R,5S,6E,10R,11S,12R,16S)-2,6,10-trimethyl-15-methylidene-13,18,19-trioxatetracyclo[9.6.1.12,5.012,16]nonadec-6-en-14-one |
| SMILES | C=C1C(=O)O[C@H]2[C@H]3O[C@@H](C[C@@H]12)[C@@]1(C)CC[C@H](O1)/C(C)=C/CC[C@H]3C |
| InChI | InChI=1S/C20H28O4/c1-11-6-5-7-12(2)17-18-14(13(3)19(21)23-18)10-16(22-17)20(4)9-8-15(11)24-20/h6,12,14-18H,3,5,7-10H2,1-2,4H3/b11-6+/t12-,14+,15+,16+,17+,18-,20-/m1/s1 |
| InChIKey | HRHWPMPIBMXXDZ-ASTUYBFISA-N |
| XLogP | 3.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|