C25H33NO2 — CID 54688661
(Z)-N,N-diethyl-3-hydroxy-2,3-bis(2,4,6-trimethylphenyl)prop-2-enamide (PubChem CID 54688661) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is (Z)-N,N-diethyl-3-hydroxy-2,3-bis(2,4,6-trimethylphenyl)prop-2-enamide.
| Compound Name | (Z)-N,N-diethyl-3-hydroxy-2,3-bis(2,4,6-trimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 54688661 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | (Z)-N,N-diethyl-3-hydroxy-2,3-bis(2,4,6-trimethylphenyl)prop-2-enamide |
| SMILES | CCN(CC)C(=O)/C(=C(\O)c1c(C)cc(C)cc1C)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C25H33NO2/c1-9-26(10-2)25(28)23(21-17(5)11-15(3)12-18(21)6)24(27)22-19(7)13-16(4)14-20(22)8/h11-14,27H,9-10H2,1-8H3/b24-23- |
| InChIKey | DFWZJPHZFRJEJQ-VHXPQNKSSA-N |
| XLogP | 5.83 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|