C6H8O7 — CID 54688710
(2R,3R,4R)-2,3,4,5-tetrahydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 54688710) has the molecular formula C6H8O7 and a molecular weight of 192.12 g/mol. Its IUPAC name is (2R,3R,4R)-2,3,4,5-tetrahydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4R)-2,3,4,5-tetrahydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 54688710 |
| Molecular Formula | C6H8O7 |
| Molecular Weight | 192.12 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | (2R,3R,4R)-2,3,4,5-tetrahydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | O=C(O)C1=C(O)[C@H](O)[C@@H](O)[C@H](O)O1 |
| InChI | InChI=1S/C6H8O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1,3,6-9,12H,(H,10,11)/t1-,3+,6+/m0/s1 |
| InChIKey | BPCLKHIDDIVGBM-QEMYTOFESA-N |
| XLogP | -2.09 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.12 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |