C28H31NO5S — CID 54688933
N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]-1-phenylmethanesulfonamide (PubChem CID 54688933) has the molecular formula C28H31NO5S and a molecular weight of 493.63 g/mol. Its IUPAC name is N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]-1-phenylmethanesulfonamide.
| Compound Name | N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 54688933 |
| Molecular Formula | C28H31NO5S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]-1-phenylmethanesulfonamide |
| SMILES | O=c1oc2c(c(O)c1C(c1cccc(NS(=O)(=O)Cc3ccccc3)c1)C1CC1)CCCCCC2 |
| InChI | InChI=1S/C28H31NO5S/c30-27-23-13-6-1-2-7-14-24(23)34-28(31)26(27)25(20-15-16-20)21-11-8-12-22(17-21)29-35(32,33)18-19-9-4-3-5-10-19/h3-5,8-12,17,20,25,29-30H,1-2,6-7,13-16,18H2 |
| InChIKey | WNBRRRPALJVUNZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |