C27H28FNO5S — CID 54688935
N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]-2-fluorobenzenesulfonamide (PubChem CID 54688935) has the molecular formula C27H28FNO5S and a molecular weight of 497.59 g/mol. Its IUPAC name is N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]-2-fluorobenzenesulfonamide.
| Compound Name | N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 54688935 |
| Molecular Formula | C27H28FNO5S |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]-2-fluorobenzenesulfonamide |
| SMILES | O=c1oc2c(c(O)c1C(c1cccc(NS(=O)(=O)c3ccccc3F)c1)C1CC1)CCCCCC2 |
| InChI | InChI=1S/C27H28FNO5S/c28-21-11-5-6-13-23(21)35(32,33)29-19-9-7-8-18(16-19)24(17-14-15-17)25-26(30)20-10-3-1-2-4-12-22(20)34-27(25)31/h5-9,11,13,16-17,24,29-30H,1-4,10,12,14-15H2 |
| InChIKey | MBBXMXNWNNAESD-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |