C29H33NO5S — CID 54688944
N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]-4-ethylbenzenesulfonamide (PubChem CID 54688944) has the molecular formula C29H33NO5S and a molecular weight of 507.65 g/mol. Its IUPAC name is N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]-4-ethylbenzenesulfonamide.
| Compound Name | N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]-4-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 54688944 |
| Molecular Formula | C29H33NO5S |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]-4-ethylbenzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2cccc(C(c3c(O)c4c(oc3=O)CCCCCC4)C3CC3)c2)cc1 |
| InChI | InChI=1S/C29H33NO5S/c1-2-19-12-16-23(17-13-19)36(33,34)30-22-9-7-8-21(18-22)26(20-14-15-20)27-28(31)24-10-5-3-4-6-11-25(24)35-29(27)32/h7-9,12-13,16-18,20,26,30-31H,2-6,10-11,14-15H2,1H3 |
| InChIKey | NOYADQYONLFGMN-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |