C30H30N2O5S — CID 54688968
N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]quinoline-8-sulfonamide (PubChem CID 54688968) has the molecular formula C30H30N2O5S and a molecular weight of 530.65 g/mol. Its IUPAC name is N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]quinoline-8-sulfonamide.
| Compound Name | N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 54688968 |
| Molecular Formula | C30H30N2O5S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]quinoline-8-sulfonamide |
| SMILES | O=c1oc2c(c(O)c1C(c1cccc(NS(=O)(=O)c3cccc4cccnc34)c1)C1CC1)CCCCCC2 |
| InChI | InChI=1S/C30H30N2O5S/c33-29-23-12-3-1-2-4-13-24(23)37-30(34)27(29)26(19-15-16-19)21-9-5-11-22(18-21)32-38(35,36)25-14-6-8-20-10-7-17-31-28(20)25/h5-11,14,17-19,26,32-33H,1-4,12-13,15-16H2 |
| InChIKey | PYQPTQJYKNBKLL-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |