C31H34N2O5S — CID 54688982
N-[3-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)-3-methylbutyl]phenyl]quinoline-8-sulfonamide (PubChem CID 54688982) has the molecular formula C31H34N2O5S and a molecular weight of 546.69 g/mol. Its IUPAC name is N-[3-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)-3-methylbutyl]phenyl]quinoline-8-sulfonamide.
| Compound Name | N-[3-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)-3-methylbutyl]phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 54688982 |
| Molecular Formula | C31H34N2O5S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | N-[3-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)-3-methylbutyl]phenyl]quinoline-8-sulfonamide |
| SMILES | CC(C)CC(c1cccc(NS(=O)(=O)c2cccc3cccnc23)c1)c1c(O)c2c(oc1=O)CCCCCC2 |
| InChI | InChI=1S/C31H34N2O5S/c1-20(2)18-25(28-30(34)24-14-5-3-4-6-15-26(24)38-31(28)35)22-11-7-13-23(19-22)33-39(36,37)27-16-8-10-21-12-9-17-32-29(21)27/h7-13,16-17,19-20,25,33-34H,3-6,14-15,18H2,1-2H3 |
| InChIKey | NFHZJXYEEPTVBN-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |