About 5-benzylsulfanyl-4-hydroxy-2-phenyl-2,3-dihydropyran-6-one
5-benzylsulfanyl-4-hydroxy-2-phenyl-2,3-dihydropyran-6-one (PubChem CID 54688983) has the molecular formula C18H16O3S
and a molecular weight of 312.39 g/mol. Its IUPAC name is 5-benzylsulfanyl-4-hydroxy-2-phenyl-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | 5-benzylsulfanyl-4-hydroxy-2-phenyl-2,3-dihydropyran-6-one |
| PubChem CID | 54688983 |
| Molecular Formula | C18H16O3S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 5-benzylsulfanyl-4-hydroxy-2-phenyl-2,3-dihydropyran-6-one |
| SMILES | O=C1OC(c2ccccc2)CC(O)=C1SCc1ccccc1 |
| InChI | InChI=1S/C18H16O3S/c19-15-11-16(14-9-5-2-6-10-14)21-18(20)17(15)22-12-13-7-3-1-4-8-13/h1-10,16,19H,11-12H2 |
| InChIKey | DJMVETQKQSTZLO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-benzylsulfanyl-4-hydroxy-2-phenyl-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzylsulfanyl-4-hydroxy-2-phenyl-2,3-dihydropyran-6-one?
The IUPAC name of 5-benzylsulfanyl-4-hydroxy-2-phenyl-2,3-dihydropyran-6-one (CID 54688983) is 5-benzylsulfanyl-4-hydroxy-2-phenyl-2,3-dihydropyran-6-one.
What is the SMILES notation for 5-benzylsulfanyl-4-hydroxy-2-phenyl-2,3-dihydropyran-6-one?
The canonical SMILES for 5-benzylsulfanyl-4-hydroxy-2-phenyl-2,3-dihydropyran-6-one is O=C1OC(c2ccccc2)CC(O)=C1SCc1ccccc1.
What is the InChIKey of 5-benzylsulfanyl-4-hydroxy-2-phenyl-2,3-dihydropyran-6-one?
The InChIKey is DJMVETQKQSTZLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16O3S/c19-15-11-16(14-9-5-2-6-10-14)21-18(20)17(15)22-12-13-7-3-1-4-8-13/h1-10,16,19H,11-12H2.
What are the key properties of 5-benzylsulfanyl-4-hydroxy-2-phenyl-2,3-dihydropyran-6-one?
5-benzylsulfanyl-4-hydroxy-2-phenyl-2,3-dihydropyran-6-one has a molecular weight of 312.39 g/mol, XLogP of 4.38, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzylsulfanyl-4-hydroxy-2-phenyl-2,3-dihydropyran-6-one is sourced from PubChem (CID 54688983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).