About 4-hydroxy-2,2-diphenyl-5-phenylsulfanyl-3H-pyran-6-one
4-hydroxy-2,2-diphenyl-5-phenylsulfanyl-3H-pyran-6-one (PubChem CID 54688986) has the molecular formula C23H18O3S
and a molecular weight of 374.46 g/mol. Its IUPAC name is 4-hydroxy-2,2-diphenyl-5-phenylsulfanyl-3H-pyran-6-one.
Molecular Properties
| Compound Name | 4-hydroxy-2,2-diphenyl-5-phenylsulfanyl-3H-pyran-6-one |
| PubChem CID | 54688986 |
| Molecular Formula | C23H18O3S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 4-hydroxy-2,2-diphenyl-5-phenylsulfanyl-3H-pyran-6-one |
| SMILES | O=C1OC(c2ccccc2)(c2ccccc2)CC(O)=C1Sc1ccccc1 |
| InChI | InChI=1S/C23H18O3S/c24-20-16-23(17-10-4-1-5-11-17,18-12-6-2-7-13-18)26-22(25)21(20)27-19-14-8-3-9-15-19/h1-15,24H,16H2 |
| InChIKey | JBCJYOQLWYPRAJ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-hydroxy-2,2-diphenyl-5-phenylsulfanyl-3H-pyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2,2-diphenyl-5-phenylsulfanyl-3H-pyran-6-one?
The IUPAC name of 4-hydroxy-2,2-diphenyl-5-phenylsulfanyl-3H-pyran-6-one (CID 54688986) is 4-hydroxy-2,2-diphenyl-5-phenylsulfanyl-3H-pyran-6-one.
What is the SMILES notation for 4-hydroxy-2,2-diphenyl-5-phenylsulfanyl-3H-pyran-6-one?
The canonical SMILES for 4-hydroxy-2,2-diphenyl-5-phenylsulfanyl-3H-pyran-6-one is O=C1OC(c2ccccc2)(c2ccccc2)CC(O)=C1Sc1ccccc1.
What is the InChIKey of 4-hydroxy-2,2-diphenyl-5-phenylsulfanyl-3H-pyran-6-one?
The InChIKey is JBCJYOQLWYPRAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18O3S/c24-20-16-23(17-10-4-1-5-11-17,18-12-6-2-7-13-18)26-22(25)21(20)27-19-14-8-3-9-15-19/h1-15,24H,16H2.
What are the key properties of 4-hydroxy-2,2-diphenyl-5-phenylsulfanyl-3H-pyran-6-one?
4-hydroxy-2,2-diphenyl-5-phenylsulfanyl-3H-pyran-6-one has a molecular weight of 374.46 g/mol, XLogP of 5.44, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2,2-diphenyl-5-phenylsulfanyl-3H-pyran-6-one is sourced from PubChem (CID 54688986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).