About diethyl (Z)-2-(2,4-dioxopyrimidin-1-yl)but-2-enedioate
diethyl (Z)-2-(2,4-dioxopyrimidin-1-yl)but-2-enedioate (PubChem CID 5468899) has the molecular formula C12H14N2O6
and a molecular weight of 282.25 g/mol. Its IUPAC name is diethyl (Z)-2-(2,4-dioxopyrimidin-1-yl)but-2-enedioate.
Molecular Properties
| Compound Name | diethyl (Z)-2-(2,4-dioxopyrimidin-1-yl)but-2-enedioate |
| PubChem CID | 5468899 |
| Molecular Formula | C12H14N2O6 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | diethyl (Z)-2-(2,4-dioxopyrimidin-1-yl)but-2-enedioate |
| SMILES | CCOC(=O)/C=C(/C(=O)OCC)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C12H14N2O6/c1-3-19-10(16)7-8(11(17)20-4-2)14-6-5-9(15)13-12(14)18/h5-7H,3-4H2,1-2H3,(H,13,15,18)/b8-7- |
| InChIKey | XYMMVIVREVUTSP-FPLPWBNLSA-N |
| XLogP | -0.50 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diethyl (Z)-2-(2,4-dioxopyrimidin-1-yl)but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (Z)-2-(2,4-dioxopyrimidin-1-yl)but-2-enedioate?
The IUPAC name of diethyl (Z)-2-(2,4-dioxopyrimidin-1-yl)but-2-enedioate (CID 5468899) is diethyl (Z)-2-(2,4-dioxopyrimidin-1-yl)but-2-enedioate.
What is the SMILES notation for diethyl (Z)-2-(2,4-dioxopyrimidin-1-yl)but-2-enedioate?
The canonical SMILES for diethyl (Z)-2-(2,4-dioxopyrimidin-1-yl)but-2-enedioate is CCOC(=O)/C=C(/C(=O)OCC)n1ccc(=O)[nH]c1=O.
What is the InChIKey of diethyl (Z)-2-(2,4-dioxopyrimidin-1-yl)but-2-enedioate?
The InChIKey is XYMMVIVREVUTSP-FPLPWBNLSA-N. The full InChI is InChI=1S/C12H14N2O6/c1-3-19-10(16)7-8(11(17)20-4-2)14-6-5-9(15)13-12(14)18/h5-7H,3-4H2,1-2H3,(H,13,15,18)/b8-7-.
What are the key properties of diethyl (Z)-2-(2,4-dioxopyrimidin-1-yl)but-2-enedioate?
diethyl (Z)-2-(2,4-dioxopyrimidin-1-yl)but-2-enedioate has a molecular weight of 282.25 g/mol, XLogP of -0.50, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (Z)-2-(2,4-dioxopyrimidin-1-yl)but-2-enedioate is sourced from PubChem (CID 5468899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).