About 2-(4-chlorophenyl)-5,7-dimethyl-1H-1,8-naphthyridin-4-one
2-(4-chlorophenyl)-5,7-dimethyl-1H-1,8-naphthyridin-4-one (PubChem CID 5468913) has the molecular formula C16H13ClN2O
and a molecular weight of 284.75 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5,7-dimethyl-1H-1,8-naphthyridin-4-one.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-5,7-dimethyl-1H-1,8-naphthyridin-4-one |
| PubChem CID | 5468913 |
| Molecular Formula | C16H13ClN2O |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 2-(4-chlorophenyl)-5,7-dimethyl-1H-1,8-naphthyridin-4-one |
| SMILES | Cc1cc(C)c2c(=O)cc(-c3ccc(Cl)cc3)[nH]c2n1 |
| InChI | InChI=1S/C16H13ClN2O/c1-9-7-10(2)18-16-15(9)14(20)8-13(19-16)11-3-5-12(17)6-4-11/h3-8H,1-2H3,(H,18,19,20) |
| InChIKey | HGJHIFICDQOWJV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-chlorophenyl)-5,7-dimethyl-1H-1,8-naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-5,7-dimethyl-1H-1,8-naphthyridin-4-one?
The IUPAC name of 2-(4-chlorophenyl)-5,7-dimethyl-1H-1,8-naphthyridin-4-one (CID 5468913) is 2-(4-chlorophenyl)-5,7-dimethyl-1H-1,8-naphthyridin-4-one.
What is the SMILES notation for 2-(4-chlorophenyl)-5,7-dimethyl-1H-1,8-naphthyridin-4-one?
The canonical SMILES for 2-(4-chlorophenyl)-5,7-dimethyl-1H-1,8-naphthyridin-4-one is Cc1cc(C)c2c(=O)cc(-c3ccc(Cl)cc3)[nH]c2n1.
What is the InChIKey of 2-(4-chlorophenyl)-5,7-dimethyl-1H-1,8-naphthyridin-4-one?
The InChIKey is HGJHIFICDQOWJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClN2O/c1-9-7-10(2)18-16-15(9)14(20)8-13(19-16)11-3-5-12(17)6-4-11/h3-8H,1-2H3,(H,18,19,20).
What are the key properties of 2-(4-chlorophenyl)-5,7-dimethyl-1H-1,8-naphthyridin-4-one?
2-(4-chlorophenyl)-5,7-dimethyl-1H-1,8-naphthyridin-4-one has a molecular weight of 284.75 g/mol, XLogP of 3.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-5,7-dimethyl-1H-1,8-naphthyridin-4-one is sourced from PubChem (CID 5468913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).