C7H9NO4 — CID 54689137
N-(3-hydroxy-2-methyl-5-oxo-2H-furan-4-yl)acetamide (PubChem CID 54689137) has the molecular formula C7H9NO4 and a molecular weight of 171.15 g/mol. Its IUPAC name is N-(3-hydroxy-2-methyl-5-oxo-2H-furan-4-yl)acetamide.
| Compound Name | N-(3-hydroxy-2-methyl-5-oxo-2H-furan-4-yl)acetamide |
|---|---|
| PubChem CID | 54689137 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | N-(3-hydroxy-2-methyl-5-oxo-2H-furan-4-yl)acetamide |
| SMILES | CC(=O)NC1=C(O)C(C)OC1=O |
| InChI | InChI=1S/C7H9NO4/c1-3-6(10)5(7(11)12-3)8-4(2)9/h3,10H,1-2H3,(H,8,9) |
| InChIKey | LUQUVNMHZDLRDP-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |