C17H14NO6- — CID 54689227
3-carboxy-4-[(4-propanoyloxybenzoyl)amino]phenolate (PubChem CID 54689227) has the molecular formula C17H14NO6- and a molecular weight of 328.30 g/mol. Its IUPAC name is 3-carboxy-4-[(4-propanoyloxybenzoyl)amino]phenolate.
| Compound Name | 3-carboxy-4-[(4-propanoyloxybenzoyl)amino]phenolate |
|---|---|
| PubChem CID | 54689227 |
| Molecular Formula | C17H14NO6- |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 3-carboxy-4-[(4-propanoyloxybenzoyl)amino]phenolate |
| SMILES | CCC(=O)Oc1ccc(C(=O)Nc2ccc([O-])cc2C(=O)O)cc1 |
| InChI | InChI=1S/C17H15NO6/c1-2-15(20)24-12-6-3-10(4-7-12)16(21)18-14-8-5-11(19)9-13(14)17(22)23/h3-9,19H,2H2,1H3,(H,18,21)(H,22,23)/p-1 |
| InChIKey | AMRKABIVIAIRKR-UHFFFAOYSA-M |
| XLogP | 2.03 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|