About 3-(2-bromo-4,6-dimethylphenyl)-4-hydroxy-6-methylpyran-2-one
3-(2-bromo-4,6-dimethylphenyl)-4-hydroxy-6-methylpyran-2-one (PubChem CID 54689691) has the molecular formula C14H13BrO3
and a molecular weight of 309.16 g/mol. Its IUPAC name is 3-(2-bromo-4,6-dimethylphenyl)-4-hydroxy-6-methylpyran-2-one.
Molecular Properties
| Compound Name | 3-(2-bromo-4,6-dimethylphenyl)-4-hydroxy-6-methylpyran-2-one |
| PubChem CID | 54689691 |
| Molecular Formula | C14H13BrO3 |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 3-(2-bromo-4,6-dimethylphenyl)-4-hydroxy-6-methylpyran-2-one |
| SMILES | Cc1cc(C)c(-c2c(O)cc(C)oc2=O)c(Br)c1 |
| InChI | InChI=1S/C14H13BrO3/c1-7-4-8(2)12(10(15)5-7)13-11(16)6-9(3)18-14(13)17/h4-6,16H,1-3H3 |
| InChIKey | MTYFPYIWOSVKPJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-bromo-4,6-dimethylphenyl)-4-hydroxy-6-methylpyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bromo-4,6-dimethylphenyl)-4-hydroxy-6-methylpyran-2-one?
The IUPAC name of 3-(2-bromo-4,6-dimethylphenyl)-4-hydroxy-6-methylpyran-2-one (CID 54689691) is 3-(2-bromo-4,6-dimethylphenyl)-4-hydroxy-6-methylpyran-2-one.
What is the SMILES notation for 3-(2-bromo-4,6-dimethylphenyl)-4-hydroxy-6-methylpyran-2-one?
The canonical SMILES for 3-(2-bromo-4,6-dimethylphenyl)-4-hydroxy-6-methylpyran-2-one is Cc1cc(C)c(-c2c(O)cc(C)oc2=O)c(Br)c1.
What is the InChIKey of 3-(2-bromo-4,6-dimethylphenyl)-4-hydroxy-6-methylpyran-2-one?
The InChIKey is MTYFPYIWOSVKPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrO3/c1-7-4-8(2)12(10(15)5-7)13-11(16)6-9(3)18-14(13)17/h4-6,16H,1-3H3.
What are the key properties of 3-(2-bromo-4,6-dimethylphenyl)-4-hydroxy-6-methylpyran-2-one?
3-(2-bromo-4,6-dimethylphenyl)-4-hydroxy-6-methylpyran-2-one has a molecular weight of 309.16 g/mol, XLogP of 3.70, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromo-4,6-dimethylphenyl)-4-hydroxy-6-methylpyran-2-one is sourced from PubChem (CID 54689691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).