C38H70O4Si2 — CID 5468982
ethyl (E,4S,5S)-6-phenyl-4,5-bis(tributylsilyloxy)hex-2-enoate (PubChem CID 5468982) has the molecular formula C38H70O4Si2 and a molecular weight of 647.15 g/mol. Its IUPAC name is ethyl (E,4S,5S)-6-phenyl-4,5-bis(tributylsilyloxy)hex-2-enoate.
| Compound Name | ethyl (E,4S,5S)-6-phenyl-4,5-bis(tributylsilyloxy)hex-2-enoate |
|---|---|
| PubChem CID | 5468982 |
| Molecular Formula | C38H70O4Si2 |
| Molecular Weight | 647.15 g/mol |
| Exact Mass | 646.48 |
| IUPAC Name | ethyl (E,4S,5S)-6-phenyl-4,5-bis(tributylsilyloxy)hex-2-enoate |
| SMILES | CCCC[Si](CCCC)(CCCC)O[C@@H](/C=C/C(=O)OCC)[C@H](Cc1ccccc1)O[Si](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C38H70O4Si2/c1-8-15-28-43(29-16-9-2,30-17-10-3)41-36(26-27-38(39)40-14-7)37(34-35-24-22-21-23-25-35)42-44(31-18-11-4,32-19-12-5)33-20-13-6/h21-27,36-37H,8-20,28-34H2,1-7H3/b27-26+/t36-,37-/m0/s1 |
| InChIKey | XCDKCRPWOWJDPF-HZRZSJFRSA-N |
| XLogP | 11.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.15 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|