C18H32O6Si — CID 5468986
[(2E,4S,5S,6E)-8-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyocta-2,6-dienyl] acetate (PubChem CID 5468986) has the molecular formula C18H32O6Si and a molecular weight of 372.53 g/mol. Its IUPAC name is [(2E,4S,5S,6E)-8-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyocta-2,6-dienyl] acetate.
| Compound Name | [(2E,4S,5S,6E)-8-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyocta-2,6-dienyl] acetate |
|---|---|
| PubChem CID | 5468986 |
| Molecular Formula | C18H32O6Si |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | [(2E,4S,5S,6E)-8-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyocta-2,6-dienyl] acetate |
| SMILES | CC(=O)OC/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)/C=C/COC(C)=O |
| InChI | InChI=1S/C18H32O6Si/c1-14(19)22-12-8-10-16(21)17(11-9-13-23-15(2)20)24-25(6,7)18(3,4)5/h8-11,16-17,21H,12-13H2,1-7H3/b10-8+,11-9+/t16-,17-/m0/s1 |
| InChIKey | XRPIUKCIFUBHHO-MORPDLRTSA-N |
| XLogP | 2.98 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|