C16H30O4Si — CID 5468988
ethyl (2E,4S,5S,6E)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyocta-2,6-dienoate (PubChem CID 5468988) has the molecular formula C16H30O4Si and a molecular weight of 314.50 g/mol. Its IUPAC name is ethyl (2E,4S,5S,6E)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyocta-2,6-dienoate.
| Compound Name | ethyl (2E,4S,5S,6E)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyocta-2,6-dienoate |
|---|---|
| PubChem CID | 5468988 |
| Molecular Formula | C16H30O4Si |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | ethyl (2E,4S,5S,6E)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyocta-2,6-dienoate |
| SMILES | C/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)/C=C/C(=O)OCC |
| InChI | InChI=1S/C16H30O4Si/c1-8-10-14(20-21(6,7)16(3,4)5)13(17)11-12-15(18)19-9-2/h8,10-14,17H,9H2,1-7H3/b10-8+,12-11+/t13-,14-/m0/s1 |
| InChIKey | SORUWOFRPURMIT-CJVQNTMISA-N |
| XLogP | 3.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|